About 2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylic acid
2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylic acid (PubChem CID 163388115) has the molecular formula C21H16Cl2N2O5
and a molecular weight of 447.27 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylic acid |
| PubChem CID | 163388115 |
| Molecular Formula | C21H16Cl2N2O5 |
| Molecular Weight | 447.27 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylic acid |
| SMILES | CCn1c(C)c(-c2ccc([N+](=O)[O-])cc2)c(=O)c(C(=O)O)c1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H16Cl2N2O5/c1-3-24-11(2)17(12-4-7-14(8-5-12)25(29)30)20(26)18(21(27)28)19(24)13-6-9-15(22)16(23)10-13/h4-10H,3H2,1-2H3,(H,27,28) |
| InChIKey | KSAXSKOLKJPJNS-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.27 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylic acid?
The IUPAC name of 2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylic acid (CID 163388115) is 2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylic acid.
What is the SMILES notation for 2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylic acid?
The canonical SMILES for 2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylic acid is CCn1c(C)c(-c2ccc([N+](=O)[O-])cc2)c(=O)c(C(=O)O)c1-c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylic acid?
The InChIKey is KSAXSKOLKJPJNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16Cl2N2O5/c1-3-24-11(2)17(12-4-7-14(8-5-12)25(29)30)20(26)18(21(27)28)19(24)13-6-9-15(22)16(23)10-13/h4-10H,3H2,1-2H3,(H,27,28).
What are the key properties of 2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylic acid?
2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylic acid has a molecular weight of 447.27 g/mol, XLogP of 5.42, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dichlorophenyl)-1-ethyl-6-methyl-5-(4-nitrophenyl)-4-oxopyridine-3-carboxylic acid is sourced from PubChem (CID 163388115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).