C56H33N7O2 — CID 163388273
6-dibenzofuran-1-yl-2-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-1-yl]-8-(2-phenylphenyl)-7H-purine (PubChem CID 163388273) has the molecular formula C56H33N7O2 and a molecular weight of 835.93 g/mol. Its IUPAC name is 6-dibenzofuran-1-yl-2-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-1-yl]-8-(2-phenylphenyl)-7H-purine.
| Compound Name | 6-dibenzofuran-1-yl-2-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-1-yl]-8-(2-phenylphenyl)-7H-purine |
|---|---|
| PubChem CID | 163388273 |
| Molecular Formula | C56H33N7O2 |
| Molecular Weight | 835.93 g/mol |
| Exact Mass | 835.27 |
| IUPAC Name | 6-dibenzofuran-1-yl-2-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-1-yl]-8-(2-phenylphenyl)-7H-purine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4oc5cccc(-c6nc(-c7cccc8oc9ccccc9c78)c7[nH]c(-c8ccccc8-c8ccccc8)nc7n6)c5c4c3)n2)cc1 |
| InChI | InChI=1S/C56H33N7O2/c1-4-16-33(17-5-1)37-22-10-11-23-38(37)54-58-50-49(40-25-14-28-45-47(40)39-24-12-13-27-43(39)64-45)57-55(63-56(50)62-54)41-26-15-29-46-48(41)42-32-36(30-31-44(42)65-46)53-60-51(34-18-6-2-7-19-34)59-52(61-53)35-20-8-3-9-21-35/h1-32H,(H,57,58,62,63) |
| InChIKey | PJXHXYWGTPSRDJ-UHFFFAOYSA-N |
| XLogP | 14.01 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.93 |
| LogP ≤ 5 | 14.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |