C23H40BNO3Si — CID 163388633
tert-butyl-dimethyl-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-4-yl]oxysilane (PubChem CID 163388633) has the molecular formula C23H40BNO3Si and a molecular weight of 417.48 g/mol. Its IUPAC name is tert-butyl-dimethyl-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-4-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-4-yl]oxysilane |
|---|---|
| PubChem CID | 163388633 |
| Molecular Formula | C23H40BNO3Si |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.29 |
| IUPAC Name | tert-butyl-dimethyl-[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperidin-4-yl]oxysilane |
| SMILES | CC1(C)OB(c2ccc(N3CCC(O[Si](C)(C)C(C)(C)C)CC3)cc2)OC1(C)C |
| InChI | InChI=1S/C23H40BNO3Si/c1-21(2,3)29(8,9)26-20-14-16-25(17-15-20)19-12-10-18(11-13-19)24-27-22(4,5)23(6,7)28-24/h10-13,20H,14-17H2,1-9H3 |
| InChIKey | RMKVIJJPTKFUEI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|