C31H33FN8O — CID 163388714
N-[1-[2-[[[2-(butylamino)-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]isoquinolin-6-yl]-2-fluoroprop-2-enamide (PubChem CID 163388714) has the molecular formula C31H33FN8O and a molecular weight of 552.66 g/mol. Its IUPAC name is N-[1-[2-[[[2-(butylamino)-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]isoquinolin-6-yl]-2-fluoroprop-2-enamide.
| Compound Name | N-[1-[2-[[[2-(butylamino)-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]isoquinolin-6-yl]-2-fluoroprop-2-enamide |
|---|---|
| PubChem CID | 163388714 |
| Molecular Formula | C31H33FN8O |
| Molecular Weight | 552.66 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | N-[1-[2-[[[2-(butylamino)-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-yl]amino]methyl]phenyl]isoquinolin-6-yl]-2-fluoroprop-2-enamide |
| SMILES | C=C(F)C(=O)Nc1ccc2c(-c3ccccc3CNc3nc(NCCCC)nc4c(C(C)C)cnn34)nccc2c1 |
| InChI | InChI=1S/C31H33FN8O/c1-5-6-14-34-30-38-28-26(19(2)3)18-36-40(28)31(39-30)35-17-22-9-7-8-10-24(22)27-25-12-11-23(37-29(41)20(4)32)16-21(25)13-15-33-27/h7-13,15-16,18-19H,4-6,14,17H2,1-3H3,(H,37,41)(H2,34,35,38,39) |
| InChIKey | YFKBXXABOGNXFQ-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 109.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.66 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|