C12H21F2N — CID 163388884
5-(2,2-difluoroethyl)-1-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline (PubChem CID 163388884) has the molecular formula C12H21F2N and a molecular weight of 217.30 g/mol. Its IUPAC name is 5-(2,2-difluoroethyl)-1-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline.
| Compound Name | 5-(2,2-difluoroethyl)-1-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline |
|---|---|
| PubChem CID | 163388884 |
| Molecular Formula | C12H21F2N |
| Molecular Weight | 217.30 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 5-(2,2-difluoroethyl)-1-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline |
| SMILES | CC1NCCC2C(CC(F)F)CCCC12 |
| InChI | InChI=1S/C12H21F2N/c1-8-10-4-2-3-9(7-12(13)14)11(10)5-6-15-8/h8-12,15H,2-7H2,1H3 |
| InChIKey | GPAXLBNKQTYQRB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |