C12H20F3N — CID 163388922
1-methyl-5-(2,2,2-trifluoroethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline (PubChem CID 163388922) has the molecular formula C12H20F3N and a molecular weight of 235.29 g/mol. Its IUPAC name is 1-methyl-5-(2,2,2-trifluoroethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline.
| Compound Name | 1-methyl-5-(2,2,2-trifluoroethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline |
|---|---|
| PubChem CID | 163388922 |
| Molecular Formula | C12H20F3N |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | 1-methyl-5-(2,2,2-trifluoroethyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline |
| SMILES | CC1NCCC2C(CC(F)(F)F)CCCC12 |
| InChI | InChI=1S/C12H20F3N/c1-8-10-4-2-3-9(7-12(13,14)15)11(10)5-6-16-8/h8-11,16H,2-7H2,1H3 |
| InChIKey | CEAXYPUHJWTFKP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |