C20H20FNO3S2 — CID 163389090
(E)-3-[[7-ethylsulfanyl-5-(4-fluorophenyl)-3,4-dihydro-2H-1,5-benzothiazepin-8-yl]oxy]prop-2-enoic acid (PubChem CID 163389090) has the molecular formula C20H20FNO3S2 and a molecular weight of 405.52 g/mol. Its IUPAC name is (E)-3-[[7-ethylsulfanyl-5-(4-fluorophenyl)-3,4-dihydro-2H-1,5-benzothiazepin-8-yl]oxy]prop-2-enoic acid.
| Compound Name | (E)-3-[[7-ethylsulfanyl-5-(4-fluorophenyl)-3,4-dihydro-2H-1,5-benzothiazepin-8-yl]oxy]prop-2-enoic acid |
|---|---|
| PubChem CID | 163389090 |
| Molecular Formula | C20H20FNO3S2 |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | (E)-3-[[7-ethylsulfanyl-5-(4-fluorophenyl)-3,4-dihydro-2H-1,5-benzothiazepin-8-yl]oxy]prop-2-enoic acid |
| SMILES | CCSc1cc2c(cc1O/C=C/C(=O)O)SCCCN2c1ccc(F)cc1 |
| InChI | InChI=1S/C20H20FNO3S2/c1-2-26-19-12-16-18(13-17(19)25-10-8-20(23)24)27-11-3-9-22(16)15-6-4-14(21)5-7-15/h4-8,10,12-13H,2-3,9,11H2,1H3,(H,23,24)/b10-8+ |
| InChIKey | MNHIZTCECWVKIA-CSKARUKUSA-N |
| XLogP | 5.55 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|