About 1-[[5-(4-fluorophenyl)-3-pyridinyl]sulfonyl]-3,4-dihydro-2H-quinoline
1-[[5-(4-fluorophenyl)-3-pyridinyl]sulfonyl]-3,4-dihydro-2H-quinoline (PubChem CID 163390049) has the molecular formula C20H17FN2O2S
and a molecular weight of 368.43 g/mol. Its IUPAC name is 1-[[5-(4-fluorophenyl)-3-pyridinyl]sulfonyl]-3,4-dihydro-2H-quinoline.
Molecular Properties
| Compound Name | 1-[[5-(4-fluorophenyl)-3-pyridinyl]sulfonyl]-3,4-dihydro-2H-quinoline |
| PubChem CID | 163390049 |
| Molecular Formula | C20H17FN2O2S |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 1-[[5-(4-fluorophenyl)-3-pyridinyl]sulfonyl]-3,4-dihydro-2H-quinoline |
| SMILES | O=S(=O)(c1cncc(-c2ccc(F)cc2)c1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C20H17FN2O2S/c21-18-9-7-15(8-10-18)17-12-19(14-22-13-17)26(24,25)23-11-3-5-16-4-1-2-6-20(16)23/h1-2,4,6-10,12-14H,3,5,11H2 |
| InChIKey | HZUAXDUWVUVCGK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[5-(4-fluorophenyl)-3-pyridinyl]sulfonyl]-3,4-dihydro-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[5-(4-fluorophenyl)-3-pyridinyl]sulfonyl]-3,4-dihydro-2H-quinoline?
The IUPAC name of 1-[[5-(4-fluorophenyl)-3-pyridinyl]sulfonyl]-3,4-dihydro-2H-quinoline (CID 163390049) is 1-[[5-(4-fluorophenyl)-3-pyridinyl]sulfonyl]-3,4-dihydro-2H-quinoline.
What is the SMILES notation for 1-[[5-(4-fluorophenyl)-3-pyridinyl]sulfonyl]-3,4-dihydro-2H-quinoline?
The canonical SMILES for 1-[[5-(4-fluorophenyl)-3-pyridinyl]sulfonyl]-3,4-dihydro-2H-quinoline is O=S(=O)(c1cncc(-c2ccc(F)cc2)c1)N1CCCc2ccccc21.
What is the InChIKey of 1-[[5-(4-fluorophenyl)-3-pyridinyl]sulfonyl]-3,4-dihydro-2H-quinoline?
The InChIKey is HZUAXDUWVUVCGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17FN2O2S/c21-18-9-7-15(8-10-18)17-12-19(14-22-13-17)26(24,25)23-11-3-5-16-4-1-2-6-20(16)23/h1-2,4,6-10,12-14H,3,5,11H2.
What are the key properties of 1-[[5-(4-fluorophenyl)-3-pyridinyl]sulfonyl]-3,4-dihydro-2H-quinoline?
1-[[5-(4-fluorophenyl)-3-pyridinyl]sulfonyl]-3,4-dihydro-2H-quinoline has a molecular weight of 368.43 g/mol, XLogP of 4.03, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[5-(4-fluorophenyl)-3-pyridinyl]sulfonyl]-3,4-dihydro-2H-quinoline is sourced from PubChem (CID 163390049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).