C24H23F3N6O — CID 163390188
6-N-[[6-[[2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]methoxy]-3-pyridinyl]methyl]isoquinoline-1,6-diamine (PubChem CID 163390188) has the molecular formula C24H23F3N6O and a molecular weight of 468.48 g/mol. Its IUPAC name is 6-N-[[6-[[2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]methoxy]-3-pyridinyl]methyl]isoquinoline-1,6-diamine.
| Compound Name | 6-N-[[6-[[2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]methoxy]-3-pyridinyl]methyl]isoquinoline-1,6-diamine |
|---|---|
| PubChem CID | 163390188 |
| Molecular Formula | C24H23F3N6O |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 6-N-[[6-[[2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]methoxy]-3-pyridinyl]methyl]isoquinoline-1,6-diamine |
| SMILES | Nc1nccc2cc(NCc3ccc(OCC4CCn5cc(C(F)(F)F)nc5C4)nc3)ccc12 |
| InChI | InChI=1S/C24H23F3N6O/c25-24(26,27)20-13-33-8-6-15(9-21(33)32-20)14-34-22-4-1-16(12-31-22)11-30-18-2-3-19-17(10-18)5-7-29-23(19)28/h1-5,7,10,12-13,15,30H,6,8-9,11,14H2,(H2,28,29) |
| InChIKey | PXSYVGNIQPEKEG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |