C11H13N3 — CID 163390323
5-propan-2-yl-2,6-naphthyridin-1-amine (PubChem CID 163390323) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 5-propan-2-yl-2,6-naphthyridin-1-amine.
| Compound Name | 5-propan-2-yl-2,6-naphthyridin-1-amine |
|---|---|
| PubChem CID | 163390323 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 5-propan-2-yl-2,6-naphthyridin-1-amine |
| SMILES | CC(C)c1nccc2c(N)nccc12 |
| InChI | InChI=1S/C11H13N3/c1-7(2)10-8-3-6-14-11(12)9(8)4-5-13-10/h3-7H,1-2H3,(H2,12,14) |
| InChIKey | AYCKCXYTVIHSBQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |