C24H27ClF2N4O4S — CID 163390650
(2Z)-2-[(E)-but-1-enyl]-3-[2-chloro-5-(difluoromethoxy)-4-pyridinyl]-5-methyl-N-[5-[[(3R)-oxolan-3-yl]methoxy]-1,3,4-thiadiazol-2-yl]hexa-2,4-dienamide (PubChem CID 163390650) has the molecular formula C24H27ClF2N4O4S and a molecular weight of 541.02 g/mol. Its IUPAC name is (2Z)-2-[(E)-but-1-enyl]-3-[2-chloro-5-(difluoromethoxy)-4-pyridinyl]-5-methyl-N-[5-[[(3R)-oxolan-3-yl]methoxy]-1,3,4-thiadiazol-2-yl]hexa-2,4-dienamide.
| Compound Name | (2Z)-2-[(E)-but-1-enyl]-3-[2-chloro-5-(difluoromethoxy)-4-pyridinyl]-5-methyl-N-[5-[[(3R)-oxolan-3-yl]methoxy]-1,3,4-thiadiazol-2-yl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 163390650 |
| Molecular Formula | C24H27ClF2N4O4S |
| Molecular Weight | 541.02 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | (2Z)-2-[(E)-but-1-enyl]-3-[2-chloro-5-(difluoromethoxy)-4-pyridinyl]-5-methyl-N-[5-[[(3R)-oxolan-3-yl]methoxy]-1,3,4-thiadiazol-2-yl]hexa-2,4-dienamide |
| SMILES | CC/C=C/C(C(=O)Nc1nnc(OC[C@@H]2CCOC2)s1)=C(\C=C(C)C)c1cc(Cl)ncc1OC(F)F |
| InChI | InChI=1S/C24H27ClF2N4O4S/c1-4-5-6-16(17(9-14(2)3)18-10-20(25)28-11-19(18)35-22(26)27)21(32)29-23-30-31-24(36-23)34-13-15-7-8-33-12-15/h5-6,9-11,15,22H,4,7-8,12-13H2,1-3H3,(H,29,30,32)/b6-5+,17-16-/t15-/m1/s1 |
| InChIKey | JOBQOTMIUDROOE-RDFPBWRISA-N |
| XLogP | 5.93 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.02 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|