C19H25FO2 — CID 163390902
(2Z,4E,6Z)-4-fluoro-5-methoxy-3-(2-methylprop-1-enyl)-2-[(E)-pent-1-enyl]nona-2,4,6,8-tetraenal (PubChem CID 163390902) has the molecular formula C19H25FO2 and a molecular weight of 304.41 g/mol. Its IUPAC name is (2Z,4E,6Z)-4-fluoro-5-methoxy-3-(2-methylprop-1-enyl)-2-[(E)-pent-1-enyl]nona-2,4,6,8-tetraenal.
| Compound Name | (2Z,4E,6Z)-4-fluoro-5-methoxy-3-(2-methylprop-1-enyl)-2-[(E)-pent-1-enyl]nona-2,4,6,8-tetraenal |
|---|---|
| PubChem CID | 163390902 |
| Molecular Formula | C19H25FO2 |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | (2Z,4E,6Z)-4-fluoro-5-methoxy-3-(2-methylprop-1-enyl)-2-[(E)-pent-1-enyl]nona-2,4,6,8-tetraenal |
| SMILES | C=C/C=C\C(OC)=C(F)\C(C=C(C)C)=C(C=O)\C=C\CCC |
| InChI | InChI=1S/C19H25FO2/c1-6-8-10-11-16(14-21)17(13-15(3)4)19(20)18(22-5)12-9-7-2/h7,9-14H,2,6,8H2,1,3-5H3/b11-10+,12-9-,17-16-,19-18+ |
| InChIKey | JWJBCIVHMCMPQW-VIYPRZQLSA-N |
| XLogP | 5.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|