About methyl (2Z)-2-[(E)-but-1-enyl]-3-[2-chloro-5-(difluoromethoxy)-4-pyridinyl]-5-methylhexa-2,4-dienoate
methyl (2Z)-2-[(E)-but-1-enyl]-3-[2-chloro-5-(difluoromethoxy)-4-pyridinyl]-5-methylhexa-2,4-dienoate (PubChem CID 163391028) has the molecular formula C18H20ClF2NO3
and a molecular weight of 371.81 g/mol. Its IUPAC name is methyl (2Z)-2-[(E)-but-1-enyl]-3-[2-chloro-5-(difluoromethoxy)-4-pyridinyl]-5-methylhexa-2,4-dienoate.
Molecular Properties
| Compound Name | methyl (2Z)-2-[(E)-but-1-enyl]-3-[2-chloro-5-(difluoromethoxy)-4-pyridinyl]-5-methylhexa-2,4-dienoate |
| PubChem CID | 163391028 |
| Molecular Formula | C18H20ClF2NO3 |
| Molecular Weight | 371.81 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | methyl (2Z)-2-[(E)-but-1-enyl]-3-[2-chloro-5-(difluoromethoxy)-4-pyridinyl]-5-methylhexa-2,4-dienoate |
| SMILES | CC/C=C/C(C(=O)OC)=C(\C=C(C)C)c1cc(Cl)ncc1OC(F)F |
| InChI | InChI=1S/C18H20ClF2NO3/c1-5-6-7-12(17(23)24-4)13(8-11(2)3)14-9-16(19)22-10-15(14)25-18(20)21/h6-10,18H,5H2,1-4H3/b7-6+,13-12- |
| InChIKey | VAKVJFCOZYYTHJ-BWLOLTEUSA-N |
| XLogP | 5.20 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.81 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl (2Z)-2-[(E)-but-1-enyl]-3-[2-chloro-5-(difluoromethoxy)-4-pyridinyl]-5-methylhexa-2,4-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2Z)-2-[(E)-but-1-enyl]-3-[2-chloro-5-(difluoromethoxy)-4-pyridinyl]-5-methylhexa-2,4-dienoate?
The IUPAC name of methyl (2Z)-2-[(E)-but-1-enyl]-3-[2-chloro-5-(difluoromethoxy)-4-pyridinyl]-5-methylhexa-2,4-dienoate (CID 163391028) is methyl (2Z)-2-[(E)-but-1-enyl]-3-[2-chloro-5-(difluoromethoxy)-4-pyridinyl]-5-methylhexa-2,4-dienoate.
What is the SMILES notation for methyl (2Z)-2-[(E)-but-1-enyl]-3-[2-chloro-5-(difluoromethoxy)-4-pyridinyl]-5-methylhexa-2,4-dienoate?
The canonical SMILES for methyl (2Z)-2-[(E)-but-1-enyl]-3-[2-chloro-5-(difluoromethoxy)-4-pyridinyl]-5-methylhexa-2,4-dienoate is CC/C=C/C(C(=O)OC)=C(\C=C(C)C)c1cc(Cl)ncc1OC(F)F.
What is the InChIKey of methyl (2Z)-2-[(E)-but-1-enyl]-3-[2-chloro-5-(difluoromethoxy)-4-pyridinyl]-5-methylhexa-2,4-dienoate?
The InChIKey is VAKVJFCOZYYTHJ-BWLOLTEUSA-N. The full InChI is InChI=1S/C18H20ClF2NO3/c1-5-6-7-12(17(23)24-4)13(8-11(2)3)14-9-16(19)22-10-15(14)25-18(20)21/h6-10,18H,5H2,1-4H3/b7-6+,13-12-.
What are the key properties of methyl (2Z)-2-[(E)-but-1-enyl]-3-[2-chloro-5-(difluoromethoxy)-4-pyridinyl]-5-methylhexa-2,4-dienoate?
methyl (2Z)-2-[(E)-but-1-enyl]-3-[2-chloro-5-(difluoromethoxy)-4-pyridinyl]-5-methylhexa-2,4-dienoate has a molecular weight of 371.81 g/mol, XLogP of 5.20, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2Z)-2-[(E)-but-1-enyl]-3-[2-chloro-5-(difluoromethoxy)-4-pyridinyl]-5-methylhexa-2,4-dienoate is sourced from PubChem (CID 163391028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).