C13H18FN3O2S — CID 163391122
5-[(3E,5E)-5-(1-ethoxyethenyl)-3-fluorohepta-3,5-dienoxy]-1,3,4-thiadiazol-2-amine (PubChem CID 163391122) has the molecular formula C13H18FN3O2S and a molecular weight of 299.37 g/mol. Its IUPAC name is 5-[(3E,5E)-5-(1-ethoxyethenyl)-3-fluorohepta-3,5-dienoxy]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[(3E,5E)-5-(1-ethoxyethenyl)-3-fluorohepta-3,5-dienoxy]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 163391122 |
| Molecular Formula | C13H18FN3O2S |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 5-[(3E,5E)-5-(1-ethoxyethenyl)-3-fluorohepta-3,5-dienoxy]-1,3,4-thiadiazol-2-amine |
| SMILES | C=C(OCC)C(/C=C(/F)CCOc1nnc(N)s1)=C/C |
| InChI | InChI=1S/C13H18FN3O2S/c1-4-10(9(3)18-5-2)8-11(14)6-7-19-13-17-16-12(15)20-13/h4,8H,3,5-7H2,1-2H3,(H2,15,16)/b10-4+,11-8+ |
| InChIKey | UQZYXDBZQYURND-HZLOGALDSA-N |
| XLogP | 3.24 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|