About O-[(4-methyloxocan-3-yl)methyl] N-aminocarbamothioate
O-[(4-methyloxocan-3-yl)methyl] N-aminocarbamothioate (PubChem CID 163391357) has the molecular formula C10H20N2O2S
and a molecular weight of 232.35 g/mol. Its IUPAC name is O-[(4-methyloxocan-3-yl)methyl] N-aminocarbamothioate.
Molecular Properties
| Compound Name | O-[(4-methyloxocan-3-yl)methyl] N-aminocarbamothioate |
| PubChem CID | 163391357 |
| Molecular Formula | C10H20N2O2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | O-[(4-methyloxocan-3-yl)methyl] N-aminocarbamothioate |
| SMILES | CC1CCCCOCC1COC(=S)NN |
| InChI | InChI=1S/C10H20N2O2S/c1-8-4-2-3-5-13-6-9(8)7-14-10(15)12-11/h8-9H,2-7,11H2,1H3,(H,12,15) |
| InChIKey | VWTOXWZUXYDKCP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-[(4-methyloxocan-3-yl)methyl] N-aminocarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[(4-methyloxocan-3-yl)methyl] N-aminocarbamothioate?
The IUPAC name of O-[(4-methyloxocan-3-yl)methyl] N-aminocarbamothioate (CID 163391357) is O-[(4-methyloxocan-3-yl)methyl] N-aminocarbamothioate.
What is the SMILES notation for O-[(4-methyloxocan-3-yl)methyl] N-aminocarbamothioate?
The canonical SMILES for O-[(4-methyloxocan-3-yl)methyl] N-aminocarbamothioate is CC1CCCCOCC1COC(=S)NN.
What is the InChIKey of O-[(4-methyloxocan-3-yl)methyl] N-aminocarbamothioate?
The InChIKey is VWTOXWZUXYDKCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O2S/c1-8-4-2-3-5-13-6-9(8)7-14-10(15)12-11/h8-9H,2-7,11H2,1H3,(H,12,15).
What are the key properties of O-[(4-methyloxocan-3-yl)methyl] N-aminocarbamothioate?
O-[(4-methyloxocan-3-yl)methyl] N-aminocarbamothioate has a molecular weight of 232.35 g/mol, XLogP of 1.20, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-[(4-methyloxocan-3-yl)methyl] N-aminocarbamothioate is sourced from PubChem (CID 163391357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).