About CID 163391497
CID 163391497 (PubChem CID 163391497) has the molecular formula C19H17ClFN5O2SU
and a molecular weight of 671.92 g/mol.
Molecular Properties
| Compound Name | CID 163391497 |
| PubChem CID | 163391497 |
| Molecular Formula | C19H17ClFN5O2SU |
| Molecular Weight | 671.92 g/mol |
| Exact Mass | 671.13 |
| IUPAC Name | — |
| SMILES | COc1cnc(Cl)cc1-c1cc(C)ncc1C(=O)Nc1nn[c-]s1.[CH2-]C1CC1F.[U+2] |
| InChI | InChI=1S/C15H11ClN5O2S.C4H6F.U/c1-8-3-9(10-4-13(16)18-6-12(10)23-2)11(5-17-8)14(22)20-15-21-19-7-24-15;1-3-2-4(3)5;/h3-6H,1-2H3,(H,20,21,22);3-4H,1-2H2;/q2*-1;+2 |
| InChIKey | ZSSNJRHEDOWJBM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 89.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 671.92 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 163391497 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163391497?
The IUPAC name of CID 163391497 (CID 163391497) is not available.
What is the SMILES notation for CID 163391497?
The canonical SMILES for CID 163391497 is COc1cnc(Cl)cc1-c1cc(C)ncc1C(=O)Nc1nn[c-]s1.[CH2-]C1CC1F.[U+2].
What is the InChIKey of CID 163391497?
The InChIKey is ZSSNJRHEDOWJBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11ClN5O2S.C4H6F.U/c1-8-3-9(10-4-13(16)18-6-12(10)23-2)11(5-17-8)14(22)20-15-21-19-7-24-15;1-3-2-4(3)5;/h3-6H,1-2H3,(H,20,21,22);3-4H,1-2H2;/q2*-1;+2.
What are the key properties of CID 163391497?
CID 163391497 has a molecular weight of 671.92 g/mol, XLogP of 4.20, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163391497 is sourced from PubChem (CID 163391497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).