C19H17ClFN5O2SU — CID 163391497
CID 163391497 (PubChem CID 163391497) has the molecular formula C19H17ClFN5O2SU and a molecular weight of 671.92 g/mol.
| Compound Name | CID 163391497 |
|---|---|
| PubChem CID | 163391497 |
| Molecular Formula | C19H17ClFN5O2SU |
| Molecular Weight | 671.92 g/mol |
| Exact Mass | 671.13 |
| IUPAC Name | — |
| SMILES | COc1cnc(Cl)cc1-c1cc(C)ncc1C(=O)Nc1nn[c-]s1.[CH2-]C1CC1F.[U+2] |
| InChI | InChI=1S/C15H11ClN5O2S.C4H6F.U/c1-8-3-9(10-4-13(16)18-6-12(10)23-2)11(5-17-8)14(22)20-15-21-19-7-24-15;1-3-2-4(3)5;/h3-6H,1-2H3,(H,20,21,22);3-4H,1-2H2;/q2*-1;+2 |
| InChIKey | ZSSNJRHEDOWJBM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 89.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.92 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|