About 5-methyl-4-nitro-1,2-oxazole-3-carbonyl chloride
5-methyl-4-nitro-1,2-oxazole-3-carbonyl chloride (PubChem CID 163391655) has the molecular formula C5H3ClN2O4
and a molecular weight of 190.54 g/mol. Its IUPAC name is 5-methyl-4-nitro-1,2-oxazole-3-carbonyl chloride.
Molecular Properties
| Compound Name | 5-methyl-4-nitro-1,2-oxazole-3-carbonyl chloride |
| PubChem CID | 163391655 |
| Molecular Formula | C5H3ClN2O4 |
| Molecular Weight | 190.54 g/mol |
| Exact Mass | 189.98 |
| IUPAC Name | 5-methyl-4-nitro-1,2-oxazole-3-carbonyl chloride |
| SMILES | Cc1onc(C(=O)Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C5H3ClN2O4/c1-2-4(8(10)11)3(5(6)9)7-12-2/h1H3 |
| InChIKey | BGJLBIKVVZRWBC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 86.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.54 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-4-nitro-1,2-oxazole-3-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4-nitro-1,2-oxazole-3-carbonyl chloride?
The IUPAC name of 5-methyl-4-nitro-1,2-oxazole-3-carbonyl chloride (CID 163391655) is 5-methyl-4-nitro-1,2-oxazole-3-carbonyl chloride.
What is the SMILES notation for 5-methyl-4-nitro-1,2-oxazole-3-carbonyl chloride?
The canonical SMILES for 5-methyl-4-nitro-1,2-oxazole-3-carbonyl chloride is Cc1onc(C(=O)Cl)c1[N+](=O)[O-].
What is the InChIKey of 5-methyl-4-nitro-1,2-oxazole-3-carbonyl chloride?
The InChIKey is BGJLBIKVVZRWBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3ClN2O4/c1-2-4(8(10)11)3(5(6)9)7-12-2/h1H3.
What are the key properties of 5-methyl-4-nitro-1,2-oxazole-3-carbonyl chloride?
5-methyl-4-nitro-1,2-oxazole-3-carbonyl chloride has a molecular weight of 190.54 g/mol, XLogP of 1.27, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-nitro-1,2-oxazole-3-carbonyl chloride is sourced from PubChem (CID 163391655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).