About ethane;7-fluoro-4-propan-2-yl-1,3-benzothiazole
ethane;7-fluoro-4-propan-2-yl-1,3-benzothiazole (PubChem CID 163391719) has the molecular formula C12H16FNS
and a molecular weight of 225.33 g/mol. Its IUPAC name is ethane;7-fluoro-4-propan-2-yl-1,3-benzothiazole.
Molecular Properties
| Compound Name | ethane;7-fluoro-4-propan-2-yl-1,3-benzothiazole |
| PubChem CID | 163391719 |
| Molecular Formula | C12H16FNS |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | ethane;7-fluoro-4-propan-2-yl-1,3-benzothiazole |
| SMILES | CC.CC(C)c1ccc(F)c2scnc12 |
| InChI | InChI=1S/C10H10FNS.C2H6/c1-6(2)7-3-4-8(11)10-9(7)12-5-13-10;1-2/h3-6H,1-2H3;1-2H3 |
| InChIKey | BQIKVIKMBQPXLO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;7-fluoro-4-propan-2-yl-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-fluoro-4-propan-2-yl-1,3-benzothiazole?
The IUPAC name of ethane;7-fluoro-4-propan-2-yl-1,3-benzothiazole (CID 163391719) is ethane;7-fluoro-4-propan-2-yl-1,3-benzothiazole.
What is the SMILES notation for ethane;7-fluoro-4-propan-2-yl-1,3-benzothiazole?
The canonical SMILES for ethane;7-fluoro-4-propan-2-yl-1,3-benzothiazole is CC.CC(C)c1ccc(F)c2scnc12.
What is the InChIKey of ethane;7-fluoro-4-propan-2-yl-1,3-benzothiazole?
The InChIKey is BQIKVIKMBQPXLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FNS.C2H6/c1-6(2)7-3-4-8(11)10-9(7)12-5-13-10;1-2/h3-6H,1-2H3;1-2H3.
What are the key properties of ethane;7-fluoro-4-propan-2-yl-1,3-benzothiazole?
ethane;7-fluoro-4-propan-2-yl-1,3-benzothiazole has a molecular weight of 225.33 g/mol, XLogP of 4.59, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-fluoro-4-propan-2-yl-1,3-benzothiazole is sourced from PubChem (CID 163391719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).