C13H14BrNO3 — CID 163391721
tert-butyl N-(4-bromo-1-benzofuran-2-yl)carbamate (PubChem CID 163391721) has the molecular formula C13H14BrNO3 and a molecular weight of 312.16 g/mol. Its IUPAC name is tert-butyl N-(4-bromo-1-benzofuran-2-yl)carbamate.
| Compound Name | tert-butyl N-(4-bromo-1-benzofuran-2-yl)carbamate |
|---|---|
| PubChem CID | 163391721 |
| Molecular Formula | C13H14BrNO3 |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | tert-butyl N-(4-bromo-1-benzofuran-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc2c(Br)cccc2o1 |
| InChI | InChI=1S/C13H14BrNO3/c1-13(2,3)18-12(16)15-11-7-8-9(14)5-4-6-10(8)17-11/h4-7H,1-3H3,(H,15,16) |
| InChIKey | LRWHMASIKXXSRR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |