C19H17F4N3O — CID 163392395
3-fluoro-4-[(3S)-3-methyl-4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]benzonitrile (PubChem CID 163392395) has the molecular formula C19H17F4N3O and a molecular weight of 379.36 g/mol. Its IUPAC name is 3-fluoro-4-[(3S)-3-methyl-4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]benzonitrile.
| Compound Name | 3-fluoro-4-[(3S)-3-methyl-4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 163392395 |
| Molecular Formula | C19H17F4N3O |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 3-fluoro-4-[(3S)-3-methyl-4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]benzonitrile |
| SMILES | C[C@H]1CN(c2ccc(C#N)cc2F)CCN1c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H17F4N3O/c1-13-12-25(18-7-2-14(11-24)10-17(18)20)8-9-26(13)15-3-5-16(6-4-15)27-19(21,22)23/h2-7,10,13H,8-9,12H2,1H3/t13-/m0/s1 |
| InChIKey | BZNCAJWFEDDOTJ-ZDUSSCGKSA-N |
| XLogP | 4.31 |
| TPSA | 39.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|