C23H21NO5 — CID 163392665
6-[3-(3,4-dihydro-1H-isoquinoline-2-carbonyloxy)prop-1-ynyl]-3,4-dihydro-2H-chromene-2-carboxylic acid (PubChem CID 163392665) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is 6-[3-(3,4-dihydro-1H-isoquinoline-2-carbonyloxy)prop-1-ynyl]-3,4-dihydro-2H-chromene-2-carboxylic acid.
| Compound Name | 6-[3-(3,4-dihydro-1H-isoquinoline-2-carbonyloxy)prop-1-ynyl]-3,4-dihydro-2H-chromene-2-carboxylic acid |
|---|---|
| PubChem CID | 163392665 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 6-[3-(3,4-dihydro-1H-isoquinoline-2-carbonyloxy)prop-1-ynyl]-3,4-dihydro-2H-chromene-2-carboxylic acid |
| SMILES | O=C(O)C1CCc2cc(C#CCOC(=O)N3CCc4ccccc4C3)ccc2O1 |
| InChI | InChI=1S/C23H21NO5/c25-22(26)21-10-8-18-14-16(7-9-20(18)29-21)4-3-13-28-23(27)24-12-11-17-5-1-2-6-19(17)15-24/h1-2,5-7,9,14,21H,8,10-13,15H2,(H,25,26) |
| InChIKey | QSCSQTPXBGJRDK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|