C19H20N2O — CID 163393950
4-phenylmethoxy-3-(2,2,5,5-tetradeuteriopyrrolidin-3-yl)-1H-indole (PubChem CID 163393950) has the molecular formula C19H20N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is 4-phenylmethoxy-3-(2,2,5,5-tetradeuteriopyrrolidin-3-yl)-1H-indole.
| Compound Name | 4-phenylmethoxy-3-(2,2,5,5-tetradeuteriopyrrolidin-3-yl)-1H-indole |
|---|---|
| PubChem CID | 163393950 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 4-phenylmethoxy-3-(2,2,5,5-tetradeuteriopyrrolidin-3-yl)-1H-indole |
| SMILES | [2H]C1([2H])CC(c2c[nH]c3cccc(OCc4ccccc4)c23)C([2H])([2H])N1 |
| InChI | InChI=1S/C19H20N2O/c1-2-5-14(6-3-1)13-22-18-8-4-7-17-19(18)16(12-21-17)15-9-10-20-11-15/h1-8,12,15,20-21H,9-11,13H2/i10D2,11D2 |
| InChIKey | MSTHTTCLMDWCHR-MKQHWYKPSA-N |
| XLogP | 3.82 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |