C17H27FN2O5 — CID 163394162
ditert-butyl (3aS,7aR)-7a-fluoro-1-oxo-3a,4,6,7-tetrahydro-3H-pyrrolo[3,4-c]pyridine-2,5-dicarboxylate (PubChem CID 163394162) has the molecular formula C17H27FN2O5 and a molecular weight of 358.41 g/mol. Its IUPAC name is ditert-butyl (3aS,7aR)-7a-fluoro-1-oxo-3a,4,6,7-tetrahydro-3H-pyrrolo[3,4-c]pyridine-2,5-dicarboxylate.
| Compound Name | ditert-butyl (3aS,7aR)-7a-fluoro-1-oxo-3a,4,6,7-tetrahydro-3H-pyrrolo[3,4-c]pyridine-2,5-dicarboxylate |
|---|---|
| PubChem CID | 163394162 |
| Molecular Formula | C17H27FN2O5 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | ditert-butyl (3aS,7aR)-7a-fluoro-1-oxo-3a,4,6,7-tetrahydro-3H-pyrrolo[3,4-c]pyridine-2,5-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@]2(F)C(=O)N(C(=O)OC(C)(C)C)C[C@@H]2C1 |
| InChI | InChI=1S/C17H27FN2O5/c1-15(2,3)24-13(22)19-8-7-17(18)11(9-19)10-20(12(17)21)14(23)25-16(4,5)6/h11H,7-10H2,1-6H3/t11-,17+/m0/s1 |
| InChIKey | PTTINRVSWCVVTQ-APPDUMDISA-N |
| XLogP | 2.73 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |