C13H19FN2O3 — CID 163394285
1-[[(3aS,7aR)-7a-fluoro-1-oxo-3,3a,4,5,6,7-hexahydropyrrolo[3,4-c]pyridin-2-yl]methyl]cyclobutane-1-carboxylic acid (PubChem CID 163394285) has the molecular formula C13H19FN2O3 and a molecular weight of 270.30 g/mol. Its IUPAC name is 1-[[(3aS,7aR)-7a-fluoro-1-oxo-3,3a,4,5,6,7-hexahydropyrrolo[3,4-c]pyridin-2-yl]methyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[[(3aS,7aR)-7a-fluoro-1-oxo-3,3a,4,5,6,7-hexahydropyrrolo[3,4-c]pyridin-2-yl]methyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 163394285 |
| Molecular Formula | C13H19FN2O3 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 1-[[(3aS,7aR)-7a-fluoro-1-oxo-3,3a,4,5,6,7-hexahydropyrrolo[3,4-c]pyridin-2-yl]methyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(CN2C[C@@H]3CNCC[C@]3(F)C2=O)CCC1 |
| InChI | InChI=1S/C13H19FN2O3/c14-13-4-5-15-6-9(13)7-16(10(13)17)8-12(11(18)19)2-1-3-12/h9,15H,1-8H2,(H,18,19)/t9-,13+/m0/s1 |
| InChIKey | WTDLARASNHFPJO-TVQRCGJNSA-N |
| XLogP | 0.40 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |