C29H19NO3 — CID 163394849
5-dibenzofuran-1-yl-1-(2-methylbenzoyl)-2-methylideneindol-3-one (PubChem CID 163394849) has the molecular formula C29H19NO3 and a molecular weight of 429.48 g/mol. Its IUPAC name is 5-dibenzofuran-1-yl-1-(2-methylbenzoyl)-2-methylideneindol-3-one.
| Compound Name | 5-dibenzofuran-1-yl-1-(2-methylbenzoyl)-2-methylideneindol-3-one |
|---|---|
| PubChem CID | 163394849 |
| Molecular Formula | C29H19NO3 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 5-dibenzofuran-1-yl-1-(2-methylbenzoyl)-2-methylideneindol-3-one |
| SMILES | C=C1C(=O)c2cc(-c3cccc4oc5ccccc5c34)ccc2N1C(=O)c1ccccc1C |
| InChI | InChI=1S/C29H19NO3/c1-17-8-3-4-9-20(17)29(32)30-18(2)28(31)23-16-19(14-15-24(23)30)21-11-7-13-26-27(21)22-10-5-6-12-25(22)33-26/h3-16H,2H2,1H3 |
| InChIKey | LLIXAGWYSSYSKI-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|