C13H21F3N2O — CID 163395343
(1R,2S,3R,4S)-3-amino-N-(3,3,3-trifluoro-2,2-dimethylpropyl)bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 163395343) has the molecular formula C13H21F3N2O and a molecular weight of 278.32 g/mol. Its IUPAC name is (1R,2S,3R,4S)-3-amino-N-(3,3,3-trifluoro-2,2-dimethylpropyl)bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1R,2S,3R,4S)-3-amino-N-(3,3,3-trifluoro-2,2-dimethylpropyl)bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 163395343 |
| Molecular Formula | C13H21F3N2O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | (1R,2S,3R,4S)-3-amino-N-(3,3,3-trifluoro-2,2-dimethylpropyl)bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CC(C)(CNC(=O)[C@H]1[C@@H]2CC[C@@H](C2)[C@H]1N)C(F)(F)F |
| InChI | InChI=1S/C13H21F3N2O/c1-12(2,13(14,15)16)6-18-11(19)9-7-3-4-8(5-7)10(9)17/h7-10H,3-6,17H2,1-2H3,(H,18,19)/t7-,8+,9+,10-/m1/s1 |
| InChIKey | PQDORIHJPCHOOK-XFWSIPNHSA-N |
| XLogP | 2.06 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |