C30H29F5N2O6 — CID 163395454
4-[2-fluoro-5-[[(1R,2R,3R,4S)-3-[[4-fluoro-3-(trifluoromethyl)phenyl]carbamoyl]-2-bicyclo[2.2.1]hept-5-enyl]carbamoyl]-4-methoxyphenoxy]cyclohexane-1-carboxylic acid (PubChem CID 163395454) has the molecular formula C30H29F5N2O6 and a molecular weight of 608.56 g/mol. Its IUPAC name is 4-[2-fluoro-5-[[(1R,2R,3R,4S)-3-[[4-fluoro-3-(trifluoromethyl)phenyl]carbamoyl]-2-bicyclo[2.2.1]hept-5-enyl]carbamoyl]-4-methoxyphenoxy]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[2-fluoro-5-[[(1R,2R,3R,4S)-3-[[4-fluoro-3-(trifluoromethyl)phenyl]carbamoyl]-2-bicyclo[2.2.1]hept-5-enyl]carbamoyl]-4-methoxyphenoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 163395454 |
| Molecular Formula | C30H29F5N2O6 |
| Molecular Weight | 608.56 g/mol |
| Exact Mass | 608.19 |
| IUPAC Name | 4-[2-fluoro-5-[[(1R,2R,3R,4S)-3-[[4-fluoro-3-(trifluoromethyl)phenyl]carbamoyl]-2-bicyclo[2.2.1]hept-5-enyl]carbamoyl]-4-methoxyphenoxy]cyclohexane-1-carboxylic acid |
| SMILES | COc1cc(F)c(OC2CCC(C(=O)O)CC2)cc1C(=O)N[C@H]1[C@H](C(=O)Nc2ccc(F)c(C(F)(F)F)c2)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C30H29F5N2O6/c1-42-23-13-22(32)24(43-18-7-4-14(5-8-18)29(40)41)12-19(23)27(38)37-26-16-3-2-15(10-16)25(26)28(39)36-17-6-9-21(31)20(11-17)30(33,34)35/h2-3,6,9,11-16,18,25-26H,4-5,7-8,10H2,1H3,(H,36,39)(H,37,38)(H,40,41)/t14?,15-,16+,18?,25-,26-/m1/s1 |
| InChIKey | CSWZZXFOKXSAGC-AZRQUTHISA-N |
| XLogP | 5.57 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.56 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|