About 3-methylcyclopentan-1-ol;N-methyl-N-(4-methylcyclohexyl)formamide
3-methylcyclopentan-1-ol;N-methyl-N-(4-methylcyclohexyl)formamide (PubChem CID 163396379) has the molecular formula C15H29NO2
and a molecular weight of 255.40 g/mol. Its IUPAC name is 3-methylcyclopentan-1-ol;N-methyl-N-(4-methylcyclohexyl)formamide.
Molecular Properties
| Compound Name | 3-methylcyclopentan-1-ol;N-methyl-N-(4-methylcyclohexyl)formamide |
| PubChem CID | 163396379 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | 3-methylcyclopentan-1-ol;N-methyl-N-(4-methylcyclohexyl)formamide |
| SMILES | CC1CCC(N(C)C=O)CC1.CC1CCC(O)C1 |
| InChI | InChI=1S/C9H17NO.C6H12O/c1-8-3-5-9(6-4-8)10(2)7-11;1-5-2-3-6(7)4-5/h7-9H,3-6H2,1-2H3;5-7H,2-4H2,1H3 |
| InChIKey | RJRVOBQZSAVZDK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-methylcyclopentan-1-ol;N-methyl-N-(4-methylcyclohexyl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylcyclopentan-1-ol;N-methyl-N-(4-methylcyclohexyl)formamide?
The IUPAC name of 3-methylcyclopentan-1-ol;N-methyl-N-(4-methylcyclohexyl)formamide (CID 163396379) is 3-methylcyclopentan-1-ol;N-methyl-N-(4-methylcyclohexyl)formamide.
What is the SMILES notation for 3-methylcyclopentan-1-ol;N-methyl-N-(4-methylcyclohexyl)formamide?
The canonical SMILES for 3-methylcyclopentan-1-ol;N-methyl-N-(4-methylcyclohexyl)formamide is CC1CCC(N(C)C=O)CC1.CC1CCC(O)C1.
What is the InChIKey of 3-methylcyclopentan-1-ol;N-methyl-N-(4-methylcyclohexyl)formamide?
The InChIKey is RJRVOBQZSAVZDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO.C6H12O/c1-8-3-5-9(6-4-8)10(2)7-11;1-5-2-3-6(7)4-5/h7-9H,3-6H2,1-2H3;5-7H,2-4H2,1H3.
What are the key properties of 3-methylcyclopentan-1-ol;N-methyl-N-(4-methylcyclohexyl)formamide?
3-methylcyclopentan-1-ol;N-methyl-N-(4-methylcyclohexyl)formamide has a molecular weight of 255.40 g/mol, XLogP of 2.82, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylcyclopentan-1-ol;N-methyl-N-(4-methylcyclohexyl)formamide is sourced from PubChem (CID 163396379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).