About ethyl 5-(difluoromethyl)-1-(5,5-difluoropiperidin-3-yl)pyrazole-4-carboxylate
ethyl 5-(difluoromethyl)-1-(5,5-difluoropiperidin-3-yl)pyrazole-4-carboxylate (PubChem CID 163396722) has the molecular formula C12H15F4N3O2
and a molecular weight of 309.26 g/mol. Its IUPAC name is ethyl 5-(difluoromethyl)-1-(5,5-difluoropiperidin-3-yl)pyrazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(difluoromethyl)-1-(5,5-difluoropiperidin-3-yl)pyrazole-4-carboxylate |
| PubChem CID | 163396722 |
| Molecular Formula | C12H15F4N3O2 |
| Molecular Weight | 309.26 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | ethyl 5-(difluoromethyl)-1-(5,5-difluoropiperidin-3-yl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C2CNCC(F)(F)C2)c1C(F)F |
| InChI | InChI=1S/C12H15F4N3O2/c1-2-21-11(20)8-5-18-19(9(8)10(13)14)7-3-12(15,16)6-17-4-7/h5,7,10,17H,2-4,6H2,1H3 |
| InChIKey | DASIHAWMAMDGNW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 5-(difluoromethyl)-1-(5,5-difluoropiperidin-3-yl)pyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(difluoromethyl)-1-(5,5-difluoropiperidin-3-yl)pyrazole-4-carboxylate?
The IUPAC name of ethyl 5-(difluoromethyl)-1-(5,5-difluoropiperidin-3-yl)pyrazole-4-carboxylate (CID 163396722) is ethyl 5-(difluoromethyl)-1-(5,5-difluoropiperidin-3-yl)pyrazole-4-carboxylate.
What is the SMILES notation for ethyl 5-(difluoromethyl)-1-(5,5-difluoropiperidin-3-yl)pyrazole-4-carboxylate?
The canonical SMILES for ethyl 5-(difluoromethyl)-1-(5,5-difluoropiperidin-3-yl)pyrazole-4-carboxylate is CCOC(=O)c1cnn(C2CNCC(F)(F)C2)c1C(F)F.
What is the InChIKey of ethyl 5-(difluoromethyl)-1-(5,5-difluoropiperidin-3-yl)pyrazole-4-carboxylate?
The InChIKey is DASIHAWMAMDGNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F4N3O2/c1-2-21-11(20)8-5-18-19(9(8)10(13)14)7-3-12(15,16)6-17-4-7/h5,7,10,17H,2-4,6H2,1H3.
What are the key properties of ethyl 5-(difluoromethyl)-1-(5,5-difluoropiperidin-3-yl)pyrazole-4-carboxylate?
ethyl 5-(difluoromethyl)-1-(5,5-difluoropiperidin-3-yl)pyrazole-4-carboxylate has a molecular weight of 309.26 g/mol, XLogP of 2.17, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(difluoromethyl)-1-(5,5-difluoropiperidin-3-yl)pyrazole-4-carboxylate is sourced from PubChem (CID 163396722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).