C24H42N2O — CID 163397103
(3S)-3-N-[1-(cyclohexa-1,5-dien-1-ylmethoxy)ethenyl]-5-methyl-2-N-prop-2-enylhex-1-ene-2,3-diamine;2-methylbutane (PubChem CID 163397103) has the molecular formula C24H42N2O and a molecular weight of 374.61 g/mol. Its IUPAC name is (3S)-3-N-[1-(cyclohexa-1,5-dien-1-ylmethoxy)ethenyl]-5-methyl-2-N-prop-2-enylhex-1-ene-2,3-diamine;2-methylbutane.
| Compound Name | (3S)-3-N-[1-(cyclohexa-1,5-dien-1-ylmethoxy)ethenyl]-5-methyl-2-N-prop-2-enylhex-1-ene-2,3-diamine;2-methylbutane |
|---|---|
| PubChem CID | 163397103 |
| Molecular Formula | C24H42N2O |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.33 |
| IUPAC Name | (3S)-3-N-[1-(cyclohexa-1,5-dien-1-ylmethoxy)ethenyl]-5-methyl-2-N-prop-2-enylhex-1-ene-2,3-diamine;2-methylbutane |
| SMILES | C=CCNC(=C)[C@H](CC(C)C)NC(=C)OCC1=CCCC=C1.CCC(C)C |
| InChI | InChI=1S/C19H30N2O.C5H12/c1-6-12-20-16(4)19(13-15(2)3)21-17(5)22-14-18-10-8-7-9-11-18;1-4-5(2)3/h6,8,10-11,15,19-21H,1,4-5,7,9,12-14H2,2-3H3;5H,4H2,1-3H3/t19-;/m0./s1 |
| InChIKey | ZMEXWOQBGXVIDM-FYZYNONXSA-N |
| XLogP | 6.10 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|