About [5-(2,4-dimethylphenyl)-4-oxocyclopent-2-en-1-yl]methyl 4-methoxybenzoate
[5-(2,4-dimethylphenyl)-4-oxocyclopent-2-en-1-yl]methyl 4-methoxybenzoate (PubChem CID 163397160) has the molecular formula C22H22O4
and a molecular weight of 350.41 g/mol. Its IUPAC name is [5-(2,4-dimethylphenyl)-4-oxocyclopent-2-en-1-yl]methyl 4-methoxybenzoate.
Molecular Properties
| Compound Name | [5-(2,4-dimethylphenyl)-4-oxocyclopent-2-en-1-yl]methyl 4-methoxybenzoate |
| PubChem CID | 163397160 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | [5-(2,4-dimethylphenyl)-4-oxocyclopent-2-en-1-yl]methyl 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC2C=CC(=O)C2c2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C22H22O4/c1-14-4-10-19(15(2)12-14)21-17(7-11-20(21)23)13-26-22(24)16-5-8-18(25-3)9-6-16/h4-12,17,21H,13H2,1-3H3 |
| InChIKey | DPBJXEHLZFUGDL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(2,4-dimethylphenyl)-4-oxocyclopent-2-en-1-yl]methyl 4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2,4-dimethylphenyl)-4-oxocyclopent-2-en-1-yl]methyl 4-methoxybenzoate?
The IUPAC name of [5-(2,4-dimethylphenyl)-4-oxocyclopent-2-en-1-yl]methyl 4-methoxybenzoate (CID 163397160) is [5-(2,4-dimethylphenyl)-4-oxocyclopent-2-en-1-yl]methyl 4-methoxybenzoate.
What is the SMILES notation for [5-(2,4-dimethylphenyl)-4-oxocyclopent-2-en-1-yl]methyl 4-methoxybenzoate?
The canonical SMILES for [5-(2,4-dimethylphenyl)-4-oxocyclopent-2-en-1-yl]methyl 4-methoxybenzoate is COc1ccc(C(=O)OCC2C=CC(=O)C2c2ccc(C)cc2C)cc1.
What is the InChIKey of [5-(2,4-dimethylphenyl)-4-oxocyclopent-2-en-1-yl]methyl 4-methoxybenzoate?
The InChIKey is DPBJXEHLZFUGDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22O4/c1-14-4-10-19(15(2)12-14)21-17(7-11-20(21)23)13-26-22(24)16-5-8-18(25-3)9-6-16/h4-12,17,21H,13H2,1-3H3.
What are the key properties of [5-(2,4-dimethylphenyl)-4-oxocyclopent-2-en-1-yl]methyl 4-methoxybenzoate?
[5-(2,4-dimethylphenyl)-4-oxocyclopent-2-en-1-yl]methyl 4-methoxybenzoate has a molecular weight of 350.41 g/mol, XLogP of 4.01, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2,4-dimethylphenyl)-4-oxocyclopent-2-en-1-yl]methyl 4-methoxybenzoate is sourced from PubChem (CID 163397160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).