About ethyl 3-bromo-7-chlorothieno[3,2-b]pyridine-6-carboxylate
ethyl 3-bromo-7-chlorothieno[3,2-b]pyridine-6-carboxylate (PubChem CID 163397206) has the molecular formula C10H7BrClNO2S
and a molecular weight of 320.60 g/mol. Its IUPAC name is ethyl 3-bromo-7-chlorothieno[3,2-b]pyridine-6-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-bromo-7-chlorothieno[3,2-b]pyridine-6-carboxylate |
| PubChem CID | 163397206 |
| Molecular Formula | C10H7BrClNO2S |
| Molecular Weight | 320.60 g/mol |
| Exact Mass | 318.91 |
| IUPAC Name | ethyl 3-bromo-7-chlorothieno[3,2-b]pyridine-6-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(Br)csc2c1Cl |
| InChI | InChI=1S/C10H7BrClNO2S/c1-2-15-10(14)5-3-13-8-6(11)4-16-9(8)7(5)12/h3-4H,2H2,1H3 |
| InChIKey | POWBOSPCJHMTSM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.60 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 3-bromo-7-chlorothieno[3,2-b]pyridine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-bromo-7-chlorothieno[3,2-b]pyridine-6-carboxylate?
The IUPAC name of ethyl 3-bromo-7-chlorothieno[3,2-b]pyridine-6-carboxylate (CID 163397206) is ethyl 3-bromo-7-chlorothieno[3,2-b]pyridine-6-carboxylate.
What is the SMILES notation for ethyl 3-bromo-7-chlorothieno[3,2-b]pyridine-6-carboxylate?
The canonical SMILES for ethyl 3-bromo-7-chlorothieno[3,2-b]pyridine-6-carboxylate is CCOC(=O)c1cnc2c(Br)csc2c1Cl.
What is the InChIKey of ethyl 3-bromo-7-chlorothieno[3,2-b]pyridine-6-carboxylate?
The InChIKey is POWBOSPCJHMTSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrClNO2S/c1-2-15-10(14)5-3-13-8-6(11)4-16-9(8)7(5)12/h3-4H,2H2,1H3.
What are the key properties of ethyl 3-bromo-7-chlorothieno[3,2-b]pyridine-6-carboxylate?
ethyl 3-bromo-7-chlorothieno[3,2-b]pyridine-6-carboxylate has a molecular weight of 320.60 g/mol, XLogP of 3.89, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-bromo-7-chlorothieno[3,2-b]pyridine-6-carboxylate is sourced from PubChem (CID 163397206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).