C21H23N3O — CID 163397662
2-cyclohexyl-N-(2-phenyl-3H-benzimidazol-5-yl)acetamide (PubChem CID 163397662) has the molecular formula C21H23N3O and a molecular weight of 333.44 g/mol. Its IUPAC name is 2-cyclohexyl-N-(2-phenyl-3H-benzimidazol-5-yl)acetamide.
| Compound Name | 2-cyclohexyl-N-(2-phenyl-3H-benzimidazol-5-yl)acetamide |
|---|---|
| PubChem CID | 163397662 |
| Molecular Formula | C21H23N3O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 2-cyclohexyl-N-(2-phenyl-3H-benzimidazol-5-yl)acetamide |
| SMILES | O=C(CC1CCCCC1)Nc1ccc2nc(-c3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C21H23N3O/c25-20(13-15-7-3-1-4-8-15)22-17-11-12-18-19(14-17)24-21(23-18)16-9-5-2-6-10-16/h2,5-6,9-12,14-15H,1,3-4,7-8,13H2,(H,22,25)(H,23,24) |
| InChIKey | XTWPKIBUWAEBBD-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |