C27H19Cl2F6N7O2 — CID 163397919
N-(cyanomethyl)-N-[1-(cyanomethyl)-5-(3,3,3-trifluoropropyl)-1,2,4-triazol-3-yl]-4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylbenzamide (PubChem CID 163397919) has the molecular formula C27H19Cl2F6N7O2 and a molecular weight of 658.39 g/mol. Its IUPAC name is N-(cyanomethyl)-N-[1-(cyanomethyl)-5-(3,3,3-trifluoropropyl)-1,2,4-triazol-3-yl]-4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylbenzamide.
| Compound Name | N-(cyanomethyl)-N-[1-(cyanomethyl)-5-(3,3,3-trifluoropropyl)-1,2,4-triazol-3-yl]-4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 163397919 |
| Molecular Formula | C27H19Cl2F6N7O2 |
| Molecular Weight | 658.39 g/mol |
| Exact Mass | 657.09 |
| IUPAC Name | N-(cyanomethyl)-N-[1-(cyanomethyl)-5-(3,3,3-trifluoropropyl)-1,2,4-triazol-3-yl]-4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylbenzamide |
| SMILES | Cc1cc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)ccc1C(=O)N(CC#N)c1nc(CCC(F)(F)F)n(CC#N)n1 |
| InChI | InChI=1S/C27H19Cl2F6N7O2/c1-15-10-16(21-14-25(44-40-21,27(33,34)35)17-11-18(28)13-19(29)12-17)2-3-20(15)23(43)41(8-6-36)24-38-22(4-5-26(30,31)32)42(39-24)9-7-37/h2-3,10-13H,4-5,8-9,14H2,1H3 |
| InChIKey | PUCBYVWXDJEGFV-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 120.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.39 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|