About 3-pyrazin-2-yl-4,5-dihydro-1,2-oxazole-5-carboxamide
3-pyrazin-2-yl-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 163398085) has the molecular formula C8H8N4O2
and a molecular weight of 192.18 g/mol. Its IUPAC name is 3-pyrazin-2-yl-4,5-dihydro-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-pyrazin-2-yl-4,5-dihydro-1,2-oxazole-5-carboxamide |
| PubChem CID | 163398085 |
| Molecular Formula | C8H8N4O2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 3-pyrazin-2-yl-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | NC(=O)C1CC(c2cnccn2)=NO1 |
| InChI | InChI=1S/C8H8N4O2/c9-8(13)7-3-5(12-14-7)6-4-10-1-2-11-6/h1-2,4,7H,3H2,(H2,9,13) |
| InChIKey | PRWVTCJYHRZTFP-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-pyrazin-2-yl-4,5-dihydro-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrazin-2-yl-4,5-dihydro-1,2-oxazole-5-carboxamide?
The IUPAC name of 3-pyrazin-2-yl-4,5-dihydro-1,2-oxazole-5-carboxamide (CID 163398085) is 3-pyrazin-2-yl-4,5-dihydro-1,2-oxazole-5-carboxamide.
What is the SMILES notation for 3-pyrazin-2-yl-4,5-dihydro-1,2-oxazole-5-carboxamide?
The canonical SMILES for 3-pyrazin-2-yl-4,5-dihydro-1,2-oxazole-5-carboxamide is NC(=O)C1CC(c2cnccn2)=NO1.
What is the InChIKey of 3-pyrazin-2-yl-4,5-dihydro-1,2-oxazole-5-carboxamide?
The InChIKey is PRWVTCJYHRZTFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O2/c9-8(13)7-3-5(12-14-7)6-4-10-1-2-11-6/h1-2,4,7H,3H2,(H2,9,13).
What are the key properties of 3-pyrazin-2-yl-4,5-dihydro-1,2-oxazole-5-carboxamide?
3-pyrazin-2-yl-4,5-dihydro-1,2-oxazole-5-carboxamide has a molecular weight of 192.18 g/mol, XLogP of -0.55, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrazin-2-yl-4,5-dihydro-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 163398085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).