C14H10N4O2 — CID 163399729
N-formyl-2-methyl-N-(2,4,8-triazabicyclo[4.2.0]octa-1(6),2,4,7-tetraen-5-yl)benzamide (PubChem CID 163399729) has the molecular formula C14H10N4O2 and a molecular weight of 266.26 g/mol. Its IUPAC name is N-formyl-2-methyl-N-(2,4,8-triazabicyclo[4.2.0]octa-1(6),2,4,7-tetraen-5-yl)benzamide.
| Compound Name | N-formyl-2-methyl-N-(2,4,8-triazabicyclo[4.2.0]octa-1(6),2,4,7-tetraen-5-yl)benzamide |
|---|---|
| PubChem CID | 163399729 |
| Molecular Formula | C14H10N4O2 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | N-formyl-2-methyl-N-(2,4,8-triazabicyclo[4.2.0]octa-1(6),2,4,7-tetraen-5-yl)benzamide |
| SMILES | Cc1ccccc1C(=O)N(C=O)c1ncnc2c1C=N2 |
| InChI | InChI=1S/C14H10N4O2/c1-9-4-2-3-5-10(9)14(20)18(8-19)13-11-6-15-12(11)16-7-17-13/h2-8H,1H3 |
| InChIKey | QBDFLXFLHLDACY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 75.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|