About N'-[3-[2-[(fluoroamino)methyl]morpholin-4-yl]propyl]-N'-methylmethanediamine
N'-[3-[2-[(fluoroamino)methyl]morpholin-4-yl]propyl]-N'-methylmethanediamine (PubChem CID 163399903) has the molecular formula C10H23FN4O
and a molecular weight of 234.32 g/mol. Its IUPAC name is N'-[3-[2-[(fluoroamino)methyl]morpholin-4-yl]propyl]-N'-methylmethanediamine.
Molecular Properties
| Compound Name | N'-[3-[2-[(fluoroamino)methyl]morpholin-4-yl]propyl]-N'-methylmethanediamine |
| PubChem CID | 163399903 |
| Molecular Formula | C10H23FN4O |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.19 |
| IUPAC Name | N'-[3-[2-[(fluoroamino)methyl]morpholin-4-yl]propyl]-N'-methylmethanediamine |
| SMILES | CN(CN)CCCN1CCOC(CNF)C1 |
| InChI | InChI=1S/C10H23FN4O/c1-14(9-12)3-2-4-15-5-6-16-10(8-15)7-13-11/h10,13H,2-9,12H2,1H3 |
| InChIKey | PDOQVGDQQRVMHX-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 53.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N'-[3-[2-[(fluoroamino)methyl]morpholin-4-yl]propyl]-N'-methylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[3-[2-[(fluoroamino)methyl]morpholin-4-yl]propyl]-N'-methylmethanediamine?
The IUPAC name of N'-[3-[2-[(fluoroamino)methyl]morpholin-4-yl]propyl]-N'-methylmethanediamine (CID 163399903) is N'-[3-[2-[(fluoroamino)methyl]morpholin-4-yl]propyl]-N'-methylmethanediamine.
What is the SMILES notation for N'-[3-[2-[(fluoroamino)methyl]morpholin-4-yl]propyl]-N'-methylmethanediamine?
The canonical SMILES for N'-[3-[2-[(fluoroamino)methyl]morpholin-4-yl]propyl]-N'-methylmethanediamine is CN(CN)CCCN1CCOC(CNF)C1.
What is the InChIKey of N'-[3-[2-[(fluoroamino)methyl]morpholin-4-yl]propyl]-N'-methylmethanediamine?
The InChIKey is PDOQVGDQQRVMHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23FN4O/c1-14(9-12)3-2-4-15-5-6-16-10(8-15)7-13-11/h10,13H,2-9,12H2,1H3.
What are the key properties of N'-[3-[2-[(fluoroamino)methyl]morpholin-4-yl]propyl]-N'-methylmethanediamine?
N'-[3-[2-[(fluoroamino)methyl]morpholin-4-yl]propyl]-N'-methylmethanediamine has a molecular weight of 234.32 g/mol, XLogP of -0.60, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[3-[2-[(fluoroamino)methyl]morpholin-4-yl]propyl]-N'-methylmethanediamine is sourced from PubChem (CID 163399903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).