C13H32N2O2 — CID 163400199
ethane;N-ethylformamide;N-(3-methoxypropyl)-2-methylpropan-1-amine (PubChem CID 163400199) has the molecular formula C13H32N2O2 and a molecular weight of 248.41 g/mol. Its IUPAC name is ethane;N-ethylformamide;N-(3-methoxypropyl)-2-methylpropan-1-amine.
| Compound Name | ethane;N-ethylformamide;N-(3-methoxypropyl)-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 163400199 |
| Molecular Formula | C13H32N2O2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.25 |
| IUPAC Name | ethane;N-ethylformamide;N-(3-methoxypropyl)-2-methylpropan-1-amine |
| SMILES | CC.CCNC=O.COCCCNCC(C)C |
| InChI | InChI=1S/C8H19NO.C3H7NO.C2H6/c1-8(2)7-9-5-4-6-10-3;1-2-4-3-5;1-2/h8-9H,4-7H2,1-3H3;3H,2H2,1H3,(H,4,5);1-2H3 |
| InChIKey | WGFJPBCMWXMDPF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|