About ethane;1-methoxybutane;4-(2-methylpropyl)morpholine
ethane;1-methoxybutane;4-(2-methylpropyl)morpholine (PubChem CID 163400303) has the molecular formula C17H41NO2
and a molecular weight of 291.52 g/mol. Its IUPAC name is ethane;1-methoxybutane;4-(2-methylpropyl)morpholine.
Molecular Properties
| Compound Name | ethane;1-methoxybutane;4-(2-methylpropyl)morpholine |
| PubChem CID | 163400303 |
| Molecular Formula | C17H41NO2 |
| Molecular Weight | 291.52 g/mol |
| Exact Mass | 291.31 |
| IUPAC Name | ethane;1-methoxybutane;4-(2-methylpropyl)morpholine |
| SMILES | CC.CC.CC(C)CN1CCOCC1.CCCCOC |
| InChI | InChI=1S/C8H17NO.C5H12O.2C2H6/c1-8(2)7-9-3-5-10-6-4-9;1-3-4-5-6-2;2*1-2/h8H,3-7H2,1-2H3;3-5H2,1-2H3;2*1-2H3 |
| InChIKey | RIQZWAYFRQMFPK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-methoxybutane;4-(2-methylpropyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methoxybutane;4-(2-methylpropyl)morpholine?
The IUPAC name of ethane;1-methoxybutane;4-(2-methylpropyl)morpholine (CID 163400303) is ethane;1-methoxybutane;4-(2-methylpropyl)morpholine.
What is the SMILES notation for ethane;1-methoxybutane;4-(2-methylpropyl)morpholine?
The canonical SMILES for ethane;1-methoxybutane;4-(2-methylpropyl)morpholine is CC.CC.CC(C)CN1CCOCC1.CCCCOC.
What is the InChIKey of ethane;1-methoxybutane;4-(2-methylpropyl)morpholine?
The InChIKey is RIQZWAYFRQMFPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO.C5H12O.2C2H6/c1-8(2)7-9-3-5-10-6-4-9;1-3-4-5-6-2;2*1-2/h8H,3-7H2,1-2H3;3-5H2,1-2H3;2*1-2H3.
What are the key properties of ethane;1-methoxybutane;4-(2-methylpropyl)morpholine?
ethane;1-methoxybutane;4-(2-methylpropyl)morpholine has a molecular weight of 291.52 g/mol, XLogP of 4.46, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methoxybutane;4-(2-methylpropyl)morpholine is sourced from PubChem (CID 163400303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).