C27H35FN4O3 — CID 163400915
(2S)-2-(ethylamino)-1-[(2S,4R)-2-[5-[4-(2-fluorophenyl)phenyl]-5-methyl-2H-1,2,4-oxadiazol-3-yl]-4-hydroxypyrrolidin-1-yl]-3,3-dimethylbutan-1-one (PubChem CID 163400915) has the molecular formula C27H35FN4O3 and a molecular weight of 482.60 g/mol. Its IUPAC name is (2S)-2-(ethylamino)-1-[(2S,4R)-2-[5-[4-(2-fluorophenyl)phenyl]-5-methyl-2H-1,2,4-oxadiazol-3-yl]-4-hydroxypyrrolidin-1-yl]-3,3-dimethylbutan-1-one.
| Compound Name | (2S)-2-(ethylamino)-1-[(2S,4R)-2-[5-[4-(2-fluorophenyl)phenyl]-5-methyl-2H-1,2,4-oxadiazol-3-yl]-4-hydroxypyrrolidin-1-yl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 163400915 |
| Molecular Formula | C27H35FN4O3 |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | (2S)-2-(ethylamino)-1-[(2S,4R)-2-[5-[4-(2-fluorophenyl)phenyl]-5-methyl-2H-1,2,4-oxadiazol-3-yl]-4-hydroxypyrrolidin-1-yl]-3,3-dimethylbutan-1-one |
| SMILES | CCN[C@H](C(=O)N1C[C@H](O)C[C@H]1C1=NC(C)(c2ccc(-c3ccccc3F)cc2)ON1)C(C)(C)C |
| InChI | InChI=1S/C27H35FN4O3/c1-6-29-23(26(2,3)4)25(34)32-16-19(33)15-22(32)24-30-27(5,35-31-24)18-13-11-17(12-14-18)20-9-7-8-10-21(20)28/h7-14,19,22-23,29,33H,6,15-16H2,1-5H3,(H,30,31)/t19-,22+,23-,27?/m1/s1 |
| InChIKey | NPCNJTIACCBHQU-YNIDZABYSA-N |
| XLogP | 3.58 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |