About ethyl 3-methyl-2-[3-(4-oxocyclohexyl)oxy-1,2-oxazol-5-yl]butanoate
ethyl 3-methyl-2-[3-(4-oxocyclohexyl)oxy-1,2-oxazol-5-yl]butanoate (PubChem CID 163401175) has the molecular formula C16H23NO5
and a molecular weight of 309.36 g/mol. Its IUPAC name is ethyl 3-methyl-2-[3-(4-oxocyclohexyl)oxy-1,2-oxazol-5-yl]butanoate.
Molecular Properties
| Compound Name | ethyl 3-methyl-2-[3-(4-oxocyclohexyl)oxy-1,2-oxazol-5-yl]butanoate |
| PubChem CID | 163401175 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | ethyl 3-methyl-2-[3-(4-oxocyclohexyl)oxy-1,2-oxazol-5-yl]butanoate |
| SMILES | CCOC(=O)C(c1cc(OC2CCC(=O)CC2)no1)C(C)C |
| InChI | InChI=1S/C16H23NO5/c1-4-20-16(19)15(10(2)3)13-9-14(17-22-13)21-12-7-5-11(18)6-8-12/h9-10,12,15H,4-8H2,1-3H3 |
| InChIKey | SKIKKBQUGNMCHX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 3-methyl-2-[3-(4-oxocyclohexyl)oxy-1,2-oxazol-5-yl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-methyl-2-[3-(4-oxocyclohexyl)oxy-1,2-oxazol-5-yl]butanoate?
The IUPAC name of ethyl 3-methyl-2-[3-(4-oxocyclohexyl)oxy-1,2-oxazol-5-yl]butanoate (CID 163401175) is ethyl 3-methyl-2-[3-(4-oxocyclohexyl)oxy-1,2-oxazol-5-yl]butanoate.
What is the SMILES notation for ethyl 3-methyl-2-[3-(4-oxocyclohexyl)oxy-1,2-oxazol-5-yl]butanoate?
The canonical SMILES for ethyl 3-methyl-2-[3-(4-oxocyclohexyl)oxy-1,2-oxazol-5-yl]butanoate is CCOC(=O)C(c1cc(OC2CCC(=O)CC2)no1)C(C)C.
What is the InChIKey of ethyl 3-methyl-2-[3-(4-oxocyclohexyl)oxy-1,2-oxazol-5-yl]butanoate?
The InChIKey is SKIKKBQUGNMCHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO5/c1-4-20-16(19)15(10(2)3)13-9-14(17-22-13)21-12-7-5-11(18)6-8-12/h9-10,12,15H,4-8H2,1-3H3.
What are the key properties of ethyl 3-methyl-2-[3-(4-oxocyclohexyl)oxy-1,2-oxazol-5-yl]butanoate?
ethyl 3-methyl-2-[3-(4-oxocyclohexyl)oxy-1,2-oxazol-5-yl]butanoate has a molecular weight of 309.36 g/mol, XLogP of 2.87, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-methyl-2-[3-(4-oxocyclohexyl)oxy-1,2-oxazol-5-yl]butanoate is sourced from PubChem (CID 163401175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).