C26H33FN4O3 — CID 163401380
(2S)-1-[(2S,4R)-2-[5-[4-(2-fluorophenyl)phenyl]-5-methyl-2H-1,2,4-oxadiazol-3-yl]-4-hydroxypyrrolidin-1-yl]-3,3-dimethyl-2-(methylamino)butan-1-one (PubChem CID 163401380) has the molecular formula C26H33FN4O3 and a molecular weight of 468.57 g/mol. Its IUPAC name is (2S)-1-[(2S,4R)-2-[5-[4-(2-fluorophenyl)phenyl]-5-methyl-2H-1,2,4-oxadiazol-3-yl]-4-hydroxypyrrolidin-1-yl]-3,3-dimethyl-2-(methylamino)butan-1-one.
| Compound Name | (2S)-1-[(2S,4R)-2-[5-[4-(2-fluorophenyl)phenyl]-5-methyl-2H-1,2,4-oxadiazol-3-yl]-4-hydroxypyrrolidin-1-yl]-3,3-dimethyl-2-(methylamino)butan-1-one |
|---|---|
| PubChem CID | 163401380 |
| Molecular Formula | C26H33FN4O3 |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | (2S)-1-[(2S,4R)-2-[5-[4-(2-fluorophenyl)phenyl]-5-methyl-2H-1,2,4-oxadiazol-3-yl]-4-hydroxypyrrolidin-1-yl]-3,3-dimethyl-2-(methylamino)butan-1-one |
| SMILES | CN[C@H](C(=O)N1C[C@H](O)C[C@H]1C1=NC(C)(c2ccc(-c3ccccc3F)cc2)ON1)C(C)(C)C |
| InChI | InChI=1S/C26H33FN4O3/c1-25(2,3)22(28-5)24(33)31-15-18(32)14-21(31)23-29-26(4,34-30-23)17-12-10-16(11-13-17)19-8-6-7-9-20(19)27/h6-13,18,21-22,28,32H,14-15H2,1-5H3,(H,29,30)/t18-,21+,22-,26?/m1/s1 |
| InChIKey | HXDCEJXSDLICKH-VBAGLBJESA-N |
| XLogP | 3.19 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |