C21H20FNO2 — CID 163401898
[(2S)-3,6-dihydro-2H-pyran-2-yl]-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone (PubChem CID 163401898) has the molecular formula C21H20FNO2 and a molecular weight of 337.39 g/mol. Its IUPAC name is [(2S)-3,6-dihydro-2H-pyran-2-yl]-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone.
| Compound Name | [(2S)-3,6-dihydro-2H-pyran-2-yl]-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
|---|---|
| PubChem CID | 163401898 |
| Molecular Formula | C21H20FNO2 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | [(2S)-3,6-dihydro-2H-pyran-2-yl]-[(1S)-1-(4-fluorophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
| SMILES | O=C([C@@H]1CC=CCO1)N1CCc2ccccc2[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C21H20FNO2/c22-17-10-8-16(9-11-17)20-18-6-2-1-5-15(18)12-13-23(20)21(24)19-7-3-4-14-25-19/h1-6,8-11,19-20H,7,12-14H2/t19-,20-/m0/s1 |
| InChIKey | UBFQDODVTZTVCT-PMACEKPBSA-N |
| XLogP | 3.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|