About fluorobenzene;(1S)-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde;(2S)-2-methyloxane
fluorobenzene;(1S)-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde;(2S)-2-methyloxane (PubChem CID 163402354) has the molecular formula C23H30FNO2
and a molecular weight of 371.50 g/mol. Its IUPAC name is fluorobenzene;(1S)-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde;(2S)-2-methyloxane.
Molecular Properties
| Compound Name | fluorobenzene;(1S)-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde;(2S)-2-methyloxane |
| PubChem CID | 163402354 |
| Molecular Formula | C23H30FNO2 |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | fluorobenzene;(1S)-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde;(2S)-2-methyloxane |
| SMILES | C[C@H]1CCCCO1.C[C@H]1c2ccccc2CCN1C=O.Fc1ccccc1 |
| InChI | InChI=1S/C11H13NO.C6H5F.C6H12O/c1-9-11-5-3-2-4-10(11)6-7-12(9)8-13;7-6-4-2-1-3-5-6;1-6-4-2-3-5-7-6/h2-5,8-9H,6-7H2,1H3;1-5H;6H,2-5H2,1H3/t9-;;6-/m0.0/s1 |
| InChIKey | AEAUAXPMELYFOX-IDHAWTNQSA-N |
| XLogP | 5.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze fluorobenzene;(1S)-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde;(2S)-2-methyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluorobenzene;(1S)-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde;(2S)-2-methyloxane?
The IUPAC name of fluorobenzene;(1S)-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde;(2S)-2-methyloxane (CID 163402354) is fluorobenzene;(1S)-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde;(2S)-2-methyloxane.
What is the SMILES notation for fluorobenzene;(1S)-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde;(2S)-2-methyloxane?
The canonical SMILES for fluorobenzene;(1S)-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde;(2S)-2-methyloxane is C[C@H]1CCCCO1.C[C@H]1c2ccccc2CCN1C=O.Fc1ccccc1.
What is the InChIKey of fluorobenzene;(1S)-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde;(2S)-2-methyloxane?
The InChIKey is AEAUAXPMELYFOX-IDHAWTNQSA-N. The full InChI is InChI=1S/C11H13NO.C6H5F.C6H12O/c1-9-11-5-3-2-4-10(11)6-7-12(9)8-13;7-6-4-2-1-3-5-6;1-6-4-2-3-5-7-6/h2-5,8-9H,6-7H2,1H3;1-5H;6H,2-5H2,1H3/t9-;;6-/m0.0/s1.
What are the key properties of fluorobenzene;(1S)-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde;(2S)-2-methyloxane?
fluorobenzene;(1S)-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde;(2S)-2-methyloxane has a molecular weight of 371.50 g/mol, XLogP of 5.16, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluorobenzene;(1S)-1-methyl-3,4-dihydro-1H-isoquinoline-2-carbaldehyde;(2S)-2-methyloxane is sourced from PubChem (CID 163402354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).