C27H47NO2 — CID 163403270
1-[2,6-dimethyl-6-[4-(2-methylbutan-2-yloxy)phenyl]hept-2-en-4-yl]piperidin-4-ol;ethane (PubChem CID 163403270) has the molecular formula C27H47NO2 and a molecular weight of 417.68 g/mol. Its IUPAC name is 1-[2,6-dimethyl-6-[4-(2-methylbutan-2-yloxy)phenyl]hept-2-en-4-yl]piperidin-4-ol;ethane.
| Compound Name | 1-[2,6-dimethyl-6-[4-(2-methylbutan-2-yloxy)phenyl]hept-2-en-4-yl]piperidin-4-ol;ethane |
|---|---|
| PubChem CID | 163403270 |
| Molecular Formula | C27H47NO2 |
| Molecular Weight | 417.68 g/mol |
| Exact Mass | 417.36 |
| IUPAC Name | 1-[2,6-dimethyl-6-[4-(2-methylbutan-2-yloxy)phenyl]hept-2-en-4-yl]piperidin-4-ol;ethane |
| SMILES | CC.CCC(C)(C)Oc1ccc(C(C)(C)CC(C=C(C)C)N2CCC(O)CC2)cc1 |
| InChI | InChI=1S/C25H41NO2.C2H6/c1-8-25(6,7)28-23-11-9-20(10-12-23)24(4,5)18-21(17-19(2)3)26-15-13-22(27)14-16-26;1-2/h9-12,17,21-22,27H,8,13-16,18H2,1-7H3;1-2H3 |
| InChIKey | QZWHXYWLPHGVCI-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.68 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|