About 1-[2,6-dimethyl-6-[4-(2-methylbutan-2-yloxy)phenyl]hept-2-en-4-yl]piperidin-4-ol;ethane
1-[2,6-dimethyl-6-[4-(2-methylbutan-2-yloxy)phenyl]hept-2-en-4-yl]piperidin-4-ol;ethane (PubChem CID 163403270) has the molecular formula C27H47NO2
and a molecular weight of 417.68 g/mol. Its IUPAC name is 1-[2,6-dimethyl-6-[4-(2-methylbutan-2-yloxy)phenyl]hept-2-en-4-yl]piperidin-4-ol;ethane.
Molecular Properties
| Compound Name | 1-[2,6-dimethyl-6-[4-(2-methylbutan-2-yloxy)phenyl]hept-2-en-4-yl]piperidin-4-ol;ethane |
| PubChem CID | 163403270 |
| Molecular Formula | C27H47NO2 |
| Molecular Weight | 417.68 g/mol |
| Exact Mass | 417.36 |
| IUPAC Name | 1-[2,6-dimethyl-6-[4-(2-methylbutan-2-yloxy)phenyl]hept-2-en-4-yl]piperidin-4-ol;ethane |
| SMILES | CC.CCC(C)(C)Oc1ccc(C(C)(C)CC(C=C(C)C)N2CCC(O)CC2)cc1 |
| InChI | InChI=1S/C25H41NO2.C2H6/c1-8-25(6,7)28-23-11-9-20(10-12-23)24(4,5)18-21(17-19(2)3)26-15-13-22(27)14-16-26;1-2/h9-12,17,21-22,27H,8,13-16,18H2,1-7H3;1-2H3 |
| InChIKey | QZWHXYWLPHGVCI-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.68 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[2,6-dimethyl-6-[4-(2-methylbutan-2-yloxy)phenyl]hept-2-en-4-yl]piperidin-4-ol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,6-dimethyl-6-[4-(2-methylbutan-2-yloxy)phenyl]hept-2-en-4-yl]piperidin-4-ol;ethane?
The IUPAC name of 1-[2,6-dimethyl-6-[4-(2-methylbutan-2-yloxy)phenyl]hept-2-en-4-yl]piperidin-4-ol;ethane (CID 163403270) is 1-[2,6-dimethyl-6-[4-(2-methylbutan-2-yloxy)phenyl]hept-2-en-4-yl]piperidin-4-ol;ethane.
What is the SMILES notation for 1-[2,6-dimethyl-6-[4-(2-methylbutan-2-yloxy)phenyl]hept-2-en-4-yl]piperidin-4-ol;ethane?
The canonical SMILES for 1-[2,6-dimethyl-6-[4-(2-methylbutan-2-yloxy)phenyl]hept-2-en-4-yl]piperidin-4-ol;ethane is CC.CCC(C)(C)Oc1ccc(C(C)(C)CC(C=C(C)C)N2CCC(O)CC2)cc1.
What is the InChIKey of 1-[2,6-dimethyl-6-[4-(2-methylbutan-2-yloxy)phenyl]hept-2-en-4-yl]piperidin-4-ol;ethane?
The InChIKey is QZWHXYWLPHGVCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H41NO2.C2H6/c1-8-25(6,7)28-23-11-9-20(10-12-23)24(4,5)18-21(17-19(2)3)26-15-13-22(27)14-16-26;1-2/h9-12,17,21-22,27H,8,13-16,18H2,1-7H3;1-2H3.
What are the key properties of 1-[2,6-dimethyl-6-[4-(2-methylbutan-2-yloxy)phenyl]hept-2-en-4-yl]piperidin-4-ol;ethane?
1-[2,6-dimethyl-6-[4-(2-methylbutan-2-yloxy)phenyl]hept-2-en-4-yl]piperidin-4-ol;ethane has a molecular weight of 417.68 g/mol, XLogP of 6.74, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,6-dimethyl-6-[4-(2-methylbutan-2-yloxy)phenyl]hept-2-en-4-yl]piperidin-4-ol;ethane is sourced from PubChem (CID 163403270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).