About 2-N-(3-chloro-4-morpholin-4-ylphenyl)-4-N-(8-methylcinnolin-4-yl)pyrimidine-2,4-diamine
2-N-(3-chloro-4-morpholin-4-ylphenyl)-4-N-(8-methylcinnolin-4-yl)pyrimidine-2,4-diamine (PubChem CID 163404096) has the molecular formula C23H22ClN7O
and a molecular weight of 447.93 g/mol. Its IUPAC name is 2-N-(3-chloro-4-morpholin-4-ylphenyl)-4-N-(8-methylcinnolin-4-yl)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 2-N-(3-chloro-4-morpholin-4-ylphenyl)-4-N-(8-methylcinnolin-4-yl)pyrimidine-2,4-diamine |
| PubChem CID | 163404096 |
| Molecular Formula | C23H22ClN7O |
| Molecular Weight | 447.93 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 2-N-(3-chloro-4-morpholin-4-ylphenyl)-4-N-(8-methylcinnolin-4-yl)pyrimidine-2,4-diamine |
| SMILES | Cc1cccc2c(Nc3ccnc(Nc4ccc(N5CCOCC5)c(Cl)c4)n3)cnnc12 |
| InChI | InChI=1S/C23H22ClN7O/c1-15-3-2-4-17-19(14-26-30-22(15)17)28-21-7-8-25-23(29-21)27-16-5-6-20(18(24)13-16)31-9-11-32-12-10-31/h2-8,13-14H,9-12H2,1H3,(H2,25,27,28,29,30) |
| InChIKey | XZKKWVDSWHRDLB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 88.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.93 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 2-N-(3-chloro-4-morpholin-4-ylphenyl)-4-N-(8-methylcinnolin-4-yl)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(3-chloro-4-morpholin-4-ylphenyl)-4-N-(8-methylcinnolin-4-yl)pyrimidine-2,4-diamine?
The IUPAC name of 2-N-(3-chloro-4-morpholin-4-ylphenyl)-4-N-(8-methylcinnolin-4-yl)pyrimidine-2,4-diamine (CID 163404096) is 2-N-(3-chloro-4-morpholin-4-ylphenyl)-4-N-(8-methylcinnolin-4-yl)pyrimidine-2,4-diamine.
What is the SMILES notation for 2-N-(3-chloro-4-morpholin-4-ylphenyl)-4-N-(8-methylcinnolin-4-yl)pyrimidine-2,4-diamine?
The canonical SMILES for 2-N-(3-chloro-4-morpholin-4-ylphenyl)-4-N-(8-methylcinnolin-4-yl)pyrimidine-2,4-diamine is Cc1cccc2c(Nc3ccnc(Nc4ccc(N5CCOCC5)c(Cl)c4)n3)cnnc12.
What is the InChIKey of 2-N-(3-chloro-4-morpholin-4-ylphenyl)-4-N-(8-methylcinnolin-4-yl)pyrimidine-2,4-diamine?
The InChIKey is XZKKWVDSWHRDLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22ClN7O/c1-15-3-2-4-17-19(14-26-30-22(15)17)28-21-7-8-25-23(29-21)27-16-5-6-20(18(24)13-16)31-9-11-32-12-10-31/h2-8,13-14H,9-12H2,1H3,(H2,25,27,28,29,30).
What are the key properties of 2-N-(3-chloro-4-morpholin-4-ylphenyl)-4-N-(8-methylcinnolin-4-yl)pyrimidine-2,4-diamine?
2-N-(3-chloro-4-morpholin-4-ylphenyl)-4-N-(8-methylcinnolin-4-yl)pyrimidine-2,4-diamine has a molecular weight of 447.93 g/mol, XLogP of 4.71, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(3-chloro-4-morpholin-4-ylphenyl)-4-N-(8-methylcinnolin-4-yl)pyrimidine-2,4-diamine is sourced from PubChem (CID 163404096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).