C25H25F3N8 — CID 163404158
4-N-(8-methylcinnolin-4-yl)-2-N-[4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]phenyl]pyrimidine-2,4-diamine (PubChem CID 163404158) has the molecular formula C25H25F3N8 and a molecular weight of 494.53 g/mol. Its IUPAC name is 4-N-(8-methylcinnolin-4-yl)-2-N-[4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]phenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(8-methylcinnolin-4-yl)-2-N-[4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 163404158 |
| Molecular Formula | C25H25F3N8 |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 4-N-(8-methylcinnolin-4-yl)-2-N-[4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]phenyl]pyrimidine-2,4-diamine |
| SMILES | Cc1cccc2c(Nc3ccnc(Nc4ccc(N5CCN(CC(F)(F)F)CC5)cc4)n3)cnnc12 |
| InChI | InChI=1S/C25H25F3N8/c1-17-3-2-4-20-21(15-30-34-23(17)20)32-22-9-10-29-24(33-22)31-18-5-7-19(8-6-18)36-13-11-35(12-14-36)16-25(26,27)28/h2-10,15H,11-14,16H2,1H3,(H2,29,31,32,33,34) |
| InChIKey | OQIXOPFGSSSVRD-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 82.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|