C24H30Cl3FN6O — CID 163404436
7-[3-[4-(3-aminopropylamino)butylamino]propylamino]-6-fluoro-2-(2,3,4-trichlorophenyl)-3H-quinazolin-4-one (PubChem CID 163404436) has the molecular formula C24H30Cl3FN6O and a molecular weight of 543.90 g/mol. Its IUPAC name is 7-[3-[4-(3-aminopropylamino)butylamino]propylamino]-6-fluoro-2-(2,3,4-trichlorophenyl)-3H-quinazolin-4-one.
| Compound Name | 7-[3-[4-(3-aminopropylamino)butylamino]propylamino]-6-fluoro-2-(2,3,4-trichlorophenyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 163404436 |
| Molecular Formula | C24H30Cl3FN6O |
| Molecular Weight | 543.90 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | 7-[3-[4-(3-aminopropylamino)butylamino]propylamino]-6-fluoro-2-(2,3,4-trichlorophenyl)-3H-quinazolin-4-one |
| SMILES | NCCCNCCCCNCCCNc1cc2nc(-c3ccc(Cl)c(Cl)c3Cl)[nH]c(=O)c2cc1F |
| InChI | InChI=1S/C24H30Cl3FN6O/c25-17-6-5-15(21(26)22(17)27)23-33-19-14-20(18(28)13-16(19)24(35)34-23)32-12-4-11-31-9-2-1-8-30-10-3-7-29/h5-6,13-14,30-32H,1-4,7-12,29H2,(H,33,34,35) |
| InChIKey | PBXWRVBNHHNYIK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.90 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|