C20H16ClF2N5O — CID 163404767
13-chloro-8-(2,6-difluorophenyl)-3-(oxan-2-yl)-3,4,7,9,11-pentazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,8,11,13-hexaene (PubChem CID 163404767) has the molecular formula C20H16ClF2N5O and a molecular weight of 415.83 g/mol. Its IUPAC name is 13-chloro-8-(2,6-difluorophenyl)-3-(oxan-2-yl)-3,4,7,9,11-pentazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,8,11,13-hexaene.
| Compound Name | 13-chloro-8-(2,6-difluorophenyl)-3-(oxan-2-yl)-3,4,7,9,11-pentazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,8,11,13-hexaene |
|---|---|
| PubChem CID | 163404767 |
| Molecular Formula | C20H16ClF2N5O |
| Molecular Weight | 415.83 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 13-chloro-8-(2,6-difluorophenyl)-3-(oxan-2-yl)-3,4,7,9,11-pentazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,8,11,13-hexaene |
| SMILES | Fc1cccc(F)c1C1=Nc2ncc(Cl)cc2-c2c(cnn2C2CCCCO2)N1 |
| InChI | InChI=1S/C20H16ClF2N5O/c21-11-8-12-18-15(10-25-28(18)16-6-1-2-7-29-16)26-20(27-19(12)24-9-11)17-13(22)4-3-5-14(17)23/h3-5,8-10,16H,1-2,6-7H2,(H,24,26,27) |
| InChIKey | ZNNVZVNLJIQVIK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.83 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |