C21H46O2Si2 — CID 163405091
[(E,3S)-4,4-dimethyl-3-triethylsilyloxyhept-5-enoxy]-triethylsilane (PubChem CID 163405091) has the molecular formula C21H46O2Si2 and a molecular weight of 386.77 g/mol. Its IUPAC name is [(E,3S)-4,4-dimethyl-3-triethylsilyloxyhept-5-enoxy]-triethylsilane.
| Compound Name | [(E,3S)-4,4-dimethyl-3-triethylsilyloxyhept-5-enoxy]-triethylsilane |
|---|---|
| PubChem CID | 163405091 |
| Molecular Formula | C21H46O2Si2 |
| Molecular Weight | 386.77 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | [(E,3S)-4,4-dimethyl-3-triethylsilyloxyhept-5-enoxy]-triethylsilane |
| SMILES | C/C=C/C(C)(C)[C@H](CCO[Si](CC)(CC)CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C21H46O2Si2/c1-10-18-21(8,9)20(23-25(14-5,15-6)16-7)17-19-22-24(11-2,12-3)13-4/h10,18,20H,11-17,19H2,1-9H3/b18-10+/t20-/m0/s1 |
| InChIKey | UZBLXIHNQFACBA-CYEGBWLXSA-N |
| XLogP | 7.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.77 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|